C22H36O5 — CID 90861370
cis-(4S,5S)-4-hydroxy-2-(3-methylbutanoyl)-5-(3-methylbutyl)-4-(4-methylhexanoyl)cyclopentane-1,3-dione (PubChem CID 90861370) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is cis-(4S,5S)-4-hydroxy-2-(3-methylbutanoyl)-5-(3-methylbutyl)-4-(4-methylhexanoyl)cyclopentane-1,3-dione.
| Compound Name | cis-(4S,5S)-4-hydroxy-2-(3-methylbutanoyl)-5-(3-methylbutyl)-4-(4-methylhexanoyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 90861370 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | cis-(4S,5S)-4-hydroxy-2-(3-methylbutanoyl)-5-(3-methylbutyl)-4-(4-methylhexanoyl)cyclopentane-1,3-dione |
| SMILES | CCC(C)CCC(=O)[C@]1(O)C(=O)C(C(=O)CC(C)C)C(=O)[C@H]1CCC(C)C |
| InChI | InChI=1S/C22H36O5/c1-7-15(6)9-11-18(24)22(27)16(10-8-13(2)3)20(25)19(21(22)26)17(23)12-14(4)5/h13-16,19,27H,7-12H2,1-6H3/t15?,16-,19?,22+/m1/s1 |
| InChIKey | CLTTYKSTHHAOIX-IYJMRZARSA-N |
| XLogP | 3.55 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|