C15H25BrO4 — CID 90862250
3-(4-bromophenyl)-5,5-dihydroxypentanoic acid;ethane (PubChem CID 90862250) has the molecular formula C15H25BrO4 and a molecular weight of 349.27 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5,5-dihydroxypentanoic acid;ethane.
| Compound Name | 3-(4-bromophenyl)-5,5-dihydroxypentanoic acid;ethane |
|---|---|
| PubChem CID | 90862250 |
| Molecular Formula | C15H25BrO4 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-(4-bromophenyl)-5,5-dihydroxypentanoic acid;ethane |
| SMILES | CC.CC.O=C(O)CC(CC(O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrO4.2C2H6/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16;2*1-2/h1-4,8,10,13-14H,5-6H2,(H,15,16);2*1-2H3 |
| InChIKey | KDUXIOKRQSFRFU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|