C23H24ClN5O2 — CID 90862377
benzyl N-[4-[(2-chloro-5-pyridin-4-ylpyrimidin-4-yl)amino]cyclohexyl]carbamate (PubChem CID 90862377) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is benzyl N-[4-[(2-chloro-5-pyridin-4-ylpyrimidin-4-yl)amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[(2-chloro-5-pyridin-4-ylpyrimidin-4-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 90862377 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | benzyl N-[4-[(2-chloro-5-pyridin-4-ylpyrimidin-4-yl)amino]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(Nc2nc(Cl)ncc2-c2ccncc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H24ClN5O2/c24-22-26-14-20(17-10-12-25-13-11-17)21(29-22)27-18-6-8-19(9-7-18)28-23(30)31-15-16-4-2-1-3-5-16/h1-5,10-14,18-19H,6-9,15H2,(H,28,30)(H,26,27,29) |
| InChIKey | IBFFHAURYVDMFK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |