C19H21N3O4 — CID 90862871
[(2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methyl]diazene (PubChem CID 90862871) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is [(2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methyl]diazene.
| Compound Name | [(2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methyl]diazene |
|---|---|
| PubChem CID | 90862871 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [(2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methyl]diazene |
| SMILES | [H]/N=N/C(c1cc(OC)c(OC)c(OC)c1)C1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C19H21N3O4/c1-23-15-9-13(10-16(24-2)18(15)25-3)17(22-20)14-11-26-19(21-14)12-7-5-4-6-8-12/h4-10,14,17,20H,11H2,1-3H3/b22-20+ |
| InChIKey | VTWYOKWRYOCNQH-LSDHQDQOSA-N |
| XLogP | 3.63 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|