C19H26FNOSSi — CID 90864086
cyclohexylmethyl N-(3-fluorophenyl)-3-trimethylsilylsulfanylprop-2-ynimidate (PubChem CID 90864086) has the molecular formula C19H26FNOSSi and a molecular weight of 363.57 g/mol. Its IUPAC name is cyclohexylmethyl N-(3-fluorophenyl)-3-trimethylsilylsulfanylprop-2-ynimidate.
| Compound Name | cyclohexylmethyl N-(3-fluorophenyl)-3-trimethylsilylsulfanylprop-2-ynimidate |
|---|---|
| PubChem CID | 90864086 |
| Molecular Formula | C19H26FNOSSi |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | cyclohexylmethyl N-(3-fluorophenyl)-3-trimethylsilylsulfanylprop-2-ynimidate |
| SMILES | C[Si](C)(C)SC#C/C(=N\c1cccc(F)c1)OCC1CCCCC1 |
| InChI | InChI=1S/C19H26FNOSSi/c1-24(2,3)23-13-12-19(21-18-11-7-10-17(20)14-18)22-15-16-8-5-4-6-9-16/h7,10-11,14,16H,4-6,8-9,15H2,1-3H3/b21-19+ |
| InChIKey | SBYKIARVFDLHOC-XUTLUUPISA-N |
| XLogP | 5.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|