C21H32O3 — CID 90866358
(8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyethyl)-10-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde (PubChem CID 90866358) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyethyl)-10-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde.
| Compound Name | (8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyethyl)-10-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde |
|---|---|
| PubChem CID | 90866358 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-11-hydroxy-17-(2-hydroxyethyl)-10-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde |
| SMILES | C[C@]12CCCC=C1CC[C@H]1[C@@H]3CC[C@H](CCO)[C@@]3(C=O)CC(O)[C@@H]12 |
| InChI | InChI=1S/C21H32O3/c1-20-10-3-2-4-14(20)5-7-16-17-8-6-15(9-11-22)21(17,13-23)12-18(24)19(16)20/h4,13,15-19,22,24H,2-3,5-12H2,1H3/t15-,16+,17+,18?,19-,20+,21+/m1/s1 |
| InChIKey | RITXFJXPNONWOD-HCGZTLJOSA-N |
| XLogP | 3.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|