C23H34O2 — CID 173405750
2-[(8S,9S,10R,13R,14S,17R)-3-ethylidene-11-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde (PubChem CID 173405750) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13R,14S,17R)-3-ethylidene-11-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde.
| Compound Name | 2-[(8S,9S,10R,13R,14S,17R)-3-ethylidene-11-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde |
|---|---|
| PubChem CID | 173405750 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-[(8S,9S,10R,13R,14S,17R)-3-ethylidene-11-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde |
| SMILES | CC=C1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](CC=O)[C@@]4(C)CC(O)[C@@H]32)C1 |
| InChI | InChI=1S/C23H34O2/c1-4-15-9-11-22(2)17(13-15)5-7-18-19-8-6-16(10-12-24)23(19,3)14-20(25)21(18)22/h4-5,12,16,18-21,25H,6-11,13-14H2,1-3H3/t16-,18+,19+,20?,21-,22+,23-/m1/s1 |
| InChIKey | LPDTXVMNWZJXFA-ACIYKYRJSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|