C9H6F8N2O2 — CID 90867102
[1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl] formate (PubChem CID 90867102) has the molecular formula C9H6F8N2O2 and a molecular weight of 326.14 g/mol. Its IUPAC name is [1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl] formate.
| Compound Name | [1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl] formate |
|---|---|
| PubChem CID | 90867102 |
| Molecular Formula | C9H6F8N2O2 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | [1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl] formate |
| SMILES | CCn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1OC=O |
| InChI | InChI=1S/C9H6F8N2O2/c1-2-19-6(21-3-20)4(8(12,13)14)5(18-19)7(10,11)9(15,16)17/h3H,2H2,1H3 |
| InChIKey | QDVYDIYHRBGEFP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|