C13H10F3N3O — CID 90867882
9-isocyano-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol (PubChem CID 90867882) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 9-isocyano-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol.
| Compound Name | 9-isocyano-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
|---|---|
| PubChem CID | 90867882 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 9-isocyano-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
| SMILES | [C-]#[N+]c1cc(C(F)(F)F)c2c(O)n3c(c2c1)CNCC3 |
| InChI | InChI=1S/C13H10F3N3O/c1-17-7-4-8-10-6-18-2-3-19(10)12(20)11(8)9(5-7)13(14,15)16/h4-5,18,20H,2-3,6H2 |
| InChIKey | DSWZHIPUKWEAKB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|