C26H27ClN4O4S — CID 90868741
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 90868741) has the molecular formula C26H27ClN4O4S and a molecular weight of 527.05 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90868741 |
| Molecular Formula | C26H27ClN4O4S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3n[nH]c(-c4ccncc4)n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C26H27ClN4O4S/c1-34-21-7-6-16(14-19(21)27)8-11-26(18-4-2-3-5-18)15-20(32)22(24(33)35-26)36-25-29-23(30-31-25)17-9-12-28-13-10-17/h6-7,9-10,12-14,18,22H,2-5,8,11,15H2,1H3,(H,29,30,31) |
| InChIKey | YCKWUHWGRDJKBD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|