C24H24ClN4O4S+ — CID 90868950
ethyl 1-[3-chloro-5-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-2-pyridinyl]-4-formylpiperidin-1-ium-1-carboxylate (PubChem CID 90868950) has the molecular formula C24H24ClN4O4S+ and a molecular weight of 500.00 g/mol. Its IUPAC name is ethyl 1-[3-chloro-5-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-2-pyridinyl]-4-formylpiperidin-1-ium-1-carboxylate.
| Compound Name | ethyl 1-[3-chloro-5-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-2-pyridinyl]-4-formylpiperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 90868950 |
| Molecular Formula | C24H24ClN4O4S+ |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | ethyl 1-[3-chloro-5-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-2-pyridinyl]-4-formylpiperidin-1-ium-1-carboxylate |
| SMILES | CCOC(=O)[N+]1(c2ncc(C(=O)Nc3nc(-c4ccccc4)cs3)cc2Cl)CCC(C=O)CC1 |
| InChI | InChI=1S/C24H23ClN4O4S/c1-2-33-24(32)29(10-8-16(14-30)9-11-29)21-19(25)12-18(13-26-21)22(31)28-23-27-20(15-34-23)17-6-4-3-5-7-17/h3-7,12-16H,2,8-11H2,1H3/p+1 |
| InChIKey | DYGZWRKHAZAAJW-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|