C27H32ClFN8O2 — CID 90869957
2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol (PubChem CID 90869957) has the molecular formula C27H32ClFN8O2 and a molecular weight of 555.06 g/mol. Its IUPAC name is 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol.
| Compound Name | 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
|---|---|
| PubChem CID | 90869957 |
| Molecular Formula | C27H32ClFN8O2 |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
| SMILES | CN1CCN(Cc2ccc(Nc3cc(Cl)c(O)c(C/N=N/c4ncc(F)c(N5CCOCC5)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C27H32ClFN8O2/c1-35-6-8-36(9-7-35)18-19-2-4-21(5-3-19)32-22-14-20(25(38)23(28)15-22)16-31-34-27-30-17-24(29)26(33-27)37-10-12-39-13-11-37/h2-5,14-15,17,32,38H,6-13,16,18H2,1H3/b34-31+ |
| InChIKey | DXPYIPOXNOPGPV-WUVHBKSUSA-N |
| XLogP | 4.59 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|