C28H22FN3O7S — CID 90870058
(4aS,5aR,12aS)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90870058) has the molecular formula C28H22FN3O7S and a molecular weight of 563.56 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90870058 |
| Molecular Formula | C28H22FN3O7S |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | (4aS,5aR,12aS)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4ccc(Nc5nc(-c6ccc(F)cc6)cs5)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C28H22FN3O7S/c29-15-4-1-11(2-5-15)17-10-40-27(32-17)31-16-6-3-12-7-13-8-14-9-18(33)21(26(30)38)25(37)28(14,39)24(36)20(13)23(35)19(12)22(16)34/h1-6,10,13-14,20-21,34,39H,7-9H2,(H2,30,38)(H,31,32)/t13-,14-,20?,21?,28-/m0/s1 |
| InChIKey | LSYIBSYWSMSAJA-VPUJYSGRSA-N |
| XLogP | 2.33 |
| TPSA | 176.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|