C24H24ClN5O2 — CID 90873579
4-[(3-chloro-4-methoxyphenyl)methylamino]-1-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phthalazine-6-carbonitrile (PubChem CID 90873579) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phthalazine-6-carbonitrile.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phthalazine-6-carbonitrile |
|---|---|
| PubChem CID | 90873579 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-(5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phthalazine-6-carbonitrile |
| SMILES | COc1ccc(CNc2nnc(N3CC4CC(O)CC4C3)c3ccc(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C24H24ClN5O2/c1-32-22-5-3-15(7-21(22)25)11-27-23-20-6-14(10-26)2-4-19(20)24(29-28-23)30-12-16-8-18(31)9-17(16)13-30/h2-7,16-18,31H,8-9,11-13H2,1H3,(H,27,28) |
| InChIKey | DPKNGCVVBGDWKW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |