C23H24ClN5O2 — CID 18342428
[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]methanol (PubChem CID 18342428) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 18342428 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]methanol |
| SMILES | [C-]#[N+]c1ccc2c(N3CCC(CO)CC3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-25-17-4-5-18-19(12-17)22(26-13-16-3-6-21(31-2)20(24)11-16)27-28-23(18)29-9-7-15(14-30)8-10-29/h3-6,11-12,15,30H,7-10,13-14H2,2H3,(H,26,27) |
| InChIKey | PUIFEVTVLVDYQF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|