C25H28ClN5O2 — CID 18342460
2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propan-1-ol (PubChem CID 18342460) has the molecular formula C25H28ClN5O2 and a molecular weight of 465.99 g/mol. Its IUPAC name is 2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propan-1-ol.
| Compound Name | 2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 18342460 |
| Molecular Formula | C25H28ClN5O2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propan-1-ol |
| SMILES | [C-]#[N+]c1ccc2c(N3CCC(C(C)CO)CC3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H28ClN5O2/c1-16(15-32)18-8-10-31(11-9-18)25-20-6-5-19(27-2)13-21(20)24(29-30-25)28-14-17-4-7-23(33-3)22(26)12-17/h4-7,12-13,16,18,32H,8-11,14-15H2,1,3H3,(H,28,29) |
| InChIKey | IAJYHHJLIMPCSD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|