C25H27Cl2N5O2 — CID 159620227
2-[1-[4-[(3-chloro-4-methylphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propanoic acid;hydrochloride (PubChem CID 159620227) has the molecular formula C25H27Cl2N5O2 and a molecular weight of 500.43 g/mol. Its IUPAC name is 2-[1-[4-[(3-chloro-4-methylphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propanoic acid;hydrochloride.
| Compound Name | 2-[1-[4-[(3-chloro-4-methylphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 159620227 |
| Molecular Formula | C25H27Cl2N5O2 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 2-[1-[4-[(3-chloro-4-methylphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-yl]propanoic acid;hydrochloride |
| SMILES | Cl.[C-]#[N+]c1ccc2c(N3CCC(C(C)C(=O)O)CC3)nnc(NCc3ccc(C)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H26ClN5O2.ClH/c1-15-4-5-17(12-22(15)26)14-28-23-21-13-19(27-3)6-7-20(21)24(30-29-23)31-10-8-18(9-11-31)16(2)25(32)33;/h4-7,12-13,16,18H,8-11,14H2,1-2H3,(H,28,29)(H,32,33);1H |
| InChIKey | UAXIAMHFLFOFOU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|