C25H23ClN8O — CID 20646862
N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-pyrimidin-2-ylpiperazin-1-yl)phthalazin-1-amine (PubChem CID 20646862) has the molecular formula C25H23ClN8O and a molecular weight of 486.97 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-pyrimidin-2-ylpiperazin-1-yl)phthalazin-1-amine.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-pyrimidin-2-ylpiperazin-1-yl)phthalazin-1-amine |
|---|---|
| PubChem CID | 20646862 |
| Molecular Formula | C25H23ClN8O |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-pyrimidin-2-ylpiperazin-1-yl)phthalazin-1-amine |
| SMILES | [C-]#[N+]c1ccc2c(N3CCN(c4ncccn4)CC3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H23ClN8O/c1-27-18-5-6-19-20(15-18)23(30-16-17-4-7-22(35-2)21(26)14-17)31-32-24(19)33-10-12-34(13-11-33)25-28-8-3-9-29-25/h3-9,14-15H,10-13,16H2,2H3,(H,30,31) |
| InChIKey | DKZJGVZQRXMGAA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|