C17H12Cl2N4O — CID 20646843
4-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-6-isocyanophthalazin-1-amine (PubChem CID 20646843) has the molecular formula C17H12Cl2N4O and a molecular weight of 359.22 g/mol. Its IUPAC name is 4-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-6-isocyanophthalazin-1-amine.
| Compound Name | 4-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-6-isocyanophthalazin-1-amine |
|---|---|
| PubChem CID | 20646843 |
| Molecular Formula | C17H12Cl2N4O |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 4-chloro-N-[(3-chloro-4-methoxyphenyl)methyl]-6-isocyanophthalazin-1-amine |
| SMILES | [C-]#[N+]c1ccc2c(NCc3ccc(OC)c(Cl)c3)nnc(Cl)c2c1 |
| InChI | InChI=1S/C17H12Cl2N4O/c1-20-11-4-5-12-13(8-11)16(19)22-23-17(12)21-9-10-3-6-15(24-2)14(18)7-10/h3-8H,9H2,2H3,(H,21,23) |
| InChIKey | RZLUKPUJPLICHU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|