C24H17ClN4O2 — CID 18342477
4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]benzaldehyde (PubChem CID 18342477) has the molecular formula C24H17ClN4O2 and a molecular weight of 428.88 g/mol. Its IUPAC name is 4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]benzaldehyde.
| Compound Name | 4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 18342477 |
| Molecular Formula | C24H17ClN4O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]benzaldehyde |
| SMILES | [C-]#[N+]c1ccc2c(-c3ccc(C=O)cc3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C24H17ClN4O2/c1-26-18-8-9-19-20(12-18)24(27-13-16-5-10-22(31-2)21(25)11-16)29-28-23(19)17-6-3-15(14-30)4-7-17/h3-12,14H,13H2,2H3,(H,27,29) |
| InChIKey | MEVNADGARIIQED-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|