C26H26ClN5O — CID 18342518
N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(3-methyl-3-pyrrolidin-1-ylbut-1-ynyl)phthalazin-1-amine (PubChem CID 18342518) has the molecular formula C26H26ClN5O and a molecular weight of 459.98 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(3-methyl-3-pyrrolidin-1-ylbut-1-ynyl)phthalazin-1-amine.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(3-methyl-3-pyrrolidin-1-ylbut-1-ynyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 18342518 |
| Molecular Formula | C26H26ClN5O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(3-methyl-3-pyrrolidin-1-ylbut-1-ynyl)phthalazin-1-amine |
| SMILES | [C-]#[N+]c1ccc2c(C#CC(C)(C)N3CCCC3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C26H26ClN5O/c1-26(2,32-13-5-6-14-32)12-11-23-20-9-8-19(28-3)16-21(20)25(31-30-23)29-17-18-7-10-24(33-4)22(27)15-18/h7-10,15-16H,5-6,13-14,17H2,1-2,4H3,(H,29,31) |
| InChIKey | WVTVIUQAIVPTEY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|