C23H18ClN5O — CID 18342473
4-(3-aminophenyl)-N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyanophthalazin-1-amine (PubChem CID 18342473) has the molecular formula C23H18ClN5O and a molecular weight of 415.88 g/mol. Its IUPAC name is 4-(3-aminophenyl)-N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyanophthalazin-1-amine.
| Compound Name | 4-(3-aminophenyl)-N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyanophthalazin-1-amine |
|---|---|
| PubChem CID | 18342473 |
| Molecular Formula | C23H18ClN5O |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-(3-aminophenyl)-N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyanophthalazin-1-amine |
| SMILES | [C-]#[N+]c1ccc2c(-c3cccc(N)c3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H18ClN5O/c1-26-17-7-8-18-19(12-17)23(27-13-14-6-9-21(30-2)20(24)10-14)29-28-22(18)15-4-3-5-16(25)11-15/h3-12H,13,25H2,2H3,(H,27,29) |
| InChIKey | UOQHWULYFOUUNT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|