C25H24Cl2N4O2S — CID 158614031
N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methylsulfinylphenyl)phthalazin-1-amine;methane;hydrochloride (PubChem CID 158614031) has the molecular formula C25H24Cl2N4O2S and a molecular weight of 515.47 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methylsulfinylphenyl)phthalazin-1-amine;methane;hydrochloride.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methylsulfinylphenyl)phthalazin-1-amine;methane;hydrochloride |
|---|---|
| PubChem CID | 158614031 |
| Molecular Formula | C25H24Cl2N4O2S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methylsulfinylphenyl)phthalazin-1-amine;methane;hydrochloride |
| SMILES | C.Cl.[C-]#[N+]c1ccc2c(-c3ccc(S(C)=O)cc3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C24H19ClN4O2S.CH4.ClH/c1-26-17-7-10-19-20(13-17)24(27-14-15-4-11-22(31-2)21(25)12-15)29-28-23(19)16-5-8-18(9-6-16)32(3)30;;/h4-13H,14H2,2-3H3,(H,27,29);1H4;1H |
| InChIKey | FOAXQIBKMSXXSY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|