C24H20Cl2N4O2 — CID 157476890
N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methoxyphenyl)phthalazin-1-amine;hydrochloride (PubChem CID 157476890) has the molecular formula C24H20Cl2N4O2 and a molecular weight of 467.36 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methoxyphenyl)phthalazin-1-amine;hydrochloride.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methoxyphenyl)phthalazin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 157476890 |
| Molecular Formula | C24H20Cl2N4O2 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-(4-methoxyphenyl)phthalazin-1-amine;hydrochloride |
| SMILES | Cl.[C-]#[N+]c1ccc2c(-c3ccc(OC)cc3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C24H19ClN4O2.ClH/c1-26-17-7-10-19-20(13-17)24(27-14-15-4-11-22(31-3)21(25)12-15)29-28-23(19)16-5-8-18(30-2)9-6-16;/h4-13H,14H2,2-3H3,(H,27,29);1H |
| InChIKey | PTQNJNXHUBPBFC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|