C23H18Cl2N4O — CID 161319791
N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-phenylphthalazin-1-amine;hydrochloride (PubChem CID 161319791) has the molecular formula C23H18Cl2N4O and a molecular weight of 437.33 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-phenylphthalazin-1-amine;hydrochloride.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-phenylphthalazin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 161319791 |
| Molecular Formula | C23H18Cl2N4O |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-7-isocyano-4-phenylphthalazin-1-amine;hydrochloride |
| SMILES | Cl.[C-]#[N+]c1ccc2c(-c3ccccc3)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H17ClN4O.ClH/c1-25-17-9-10-18-19(13-17)23(28-27-22(18)16-6-4-3-5-7-16)26-14-15-8-11-21(29-2)20(24)12-15;/h3-13H,14H2,2H3,(H,26,28);1H |
| InChIKey | INKFGJCHJAQRBT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|