C22H23ClIN5O2 — CID 162243259
1-[4-[(3-iodo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-ol;hydrochloride (PubChem CID 162243259) has the molecular formula C22H23ClIN5O2 and a molecular weight of 551.82 g/mol. Its IUPAC name is 1-[4-[(3-iodo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-ol;hydrochloride.
| Compound Name | 1-[4-[(3-iodo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 162243259 |
| Molecular Formula | C22H23ClIN5O2 |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 1-[4-[(3-iodo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]piperidin-4-ol;hydrochloride |
| SMILES | Cl.[C-]#[N+]c1ccc2c(N3CCC(O)CC3)nnc(NCc3ccc(OC)c(I)c3)c2c1 |
| InChI | InChI=1S/C22H22IN5O2.ClH/c1-24-15-4-5-17-18(12-15)21(25-13-14-3-6-20(30-2)19(23)11-14)26-27-22(17)28-9-7-16(29)8-10-28;/h3-6,11-12,16,29H,7-10,13H2,2H3,(H,25,26);1H |
| InChIKey | JQYNTSRANXZWRQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|