C22H23BrClN5O2 — CID 158874888
[1-[4-[(3-bromo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]pyrrolidin-3-yl]methanol;hydrochloride (PubChem CID 158874888) has the molecular formula C22H23BrClN5O2 and a molecular weight of 504.82 g/mol. Its IUPAC name is [1-[4-[(3-bromo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]pyrrolidin-3-yl]methanol;hydrochloride.
| Compound Name | [1-[4-[(3-bromo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]pyrrolidin-3-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 158874888 |
| Molecular Formula | C22H23BrClN5O2 |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | [1-[4-[(3-bromo-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]pyrrolidin-3-yl]methanol;hydrochloride |
| SMILES | Cl.[C-]#[N+]c1ccc2c(N3CCC(CO)C3)nnc(NCc3ccc(OC)c(Br)c3)c2c1 |
| InChI | InChI=1S/C22H22BrN5O2.ClH/c1-24-16-4-5-17-18(10-16)21(25-11-14-3-6-20(30-2)19(23)9-14)26-27-22(17)28-8-7-15(12-28)13-29;/h3-6,9-10,15,29H,7-8,11-13H2,2H3,(H,25,26);1H |
| InChIKey | KDHSVLAOXPCJPV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|