C25H24ClN5O3 — CID 18342503
8-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]-2-oxa-8-azaspiro[4.5]decan-3-one (PubChem CID 18342503) has the molecular formula C25H24ClN5O3 and a molecular weight of 477.95 g/mol. Its IUPAC name is 8-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]-2-oxa-8-azaspiro[4.5]decan-3-one.
| Compound Name | 8-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]-2-oxa-8-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 18342503 |
| Molecular Formula | C25H24ClN5O3 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 8-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-isocyanophthalazin-1-yl]-2-oxa-8-azaspiro[4.5]decan-3-one |
| SMILES | [C-]#[N+]c1ccc2c(N3CCC4(CC3)COC(=O)C4)nnc(NCc3ccc(OC)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H24ClN5O3/c1-27-17-4-5-18-19(12-17)23(28-14-16-3-6-21(33-2)20(26)11-16)29-30-24(18)31-9-7-25(8-10-31)13-22(32)34-15-25/h3-6,11-12H,7-10,13-15H2,2H3,(H,28,29) |
| InChIKey | MKGALFBEVORSEO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|