C23H22ClN5 — CID 20628234
N-[(3-chloro-4-methylphenyl)methyl]-7-isocyano-4-(4-methylidenepiperidin-1-yl)phthalazin-1-amine (PubChem CID 20628234) has the molecular formula C23H22ClN5 and a molecular weight of 403.92 g/mol. Its IUPAC name is N-[(3-chloro-4-methylphenyl)methyl]-7-isocyano-4-(4-methylidenepiperidin-1-yl)phthalazin-1-amine.
| Compound Name | N-[(3-chloro-4-methylphenyl)methyl]-7-isocyano-4-(4-methylidenepiperidin-1-yl)phthalazin-1-amine |
|---|---|
| PubChem CID | 20628234 |
| Molecular Formula | C23H22ClN5 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[(3-chloro-4-methylphenyl)methyl]-7-isocyano-4-(4-methylidenepiperidin-1-yl)phthalazin-1-amine |
| SMILES | [C-]#[N+]c1ccc2c(N3CCC(=C)CC3)nnc(NCc3ccc(C)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H22ClN5/c1-15-8-10-29(11-9-15)23-19-7-6-18(25-3)13-20(19)22(27-28-23)26-14-17-5-4-16(2)21(24)12-17/h4-7,12-13H,1,8-11,14H2,2H3,(H,26,27) |
| InChIKey | XVGBNWAQOQGWBF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 45.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|