C21H20ClN5OS — CID 11798261
4-[(3-chloro-4-methoxyphenyl)methylamino]-8-thiomorpholin-4-ylphthalazine-6-carbonitrile (PubChem CID 11798261) has the molecular formula C21H20ClN5OS and a molecular weight of 425.95 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-8-thiomorpholin-4-ylphthalazine-6-carbonitrile.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-8-thiomorpholin-4-ylphthalazine-6-carbonitrile |
|---|---|
| PubChem CID | 11798261 |
| Molecular Formula | C21H20ClN5OS |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-8-thiomorpholin-4-ylphthalazine-6-carbonitrile |
| SMILES | COc1ccc(CNc2nncc3c(N4CCSCC4)cc(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C21H20ClN5OS/c1-28-20-3-2-14(9-18(20)22)12-24-21-16-8-15(11-23)10-19(17(16)13-25-26-21)27-4-6-29-7-5-27/h2-3,8-10,13H,4-7,12H2,1H3,(H,24,26) |
| InChIKey | WUYMFXSNWYWQTF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |