C21H22ClN5O4 — CID 10814568
1-[1-[(3-chloro-4-methoxyphenyl)methylamino]-7-nitrophthalazin-5-yl]piperidin-4-ol (PubChem CID 10814568) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is 1-[1-[(3-chloro-4-methoxyphenyl)methylamino]-7-nitrophthalazin-5-yl]piperidin-4-ol.
| Compound Name | 1-[1-[(3-chloro-4-methoxyphenyl)methylamino]-7-nitrophthalazin-5-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 10814568 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[1-[(3-chloro-4-methoxyphenyl)methylamino]-7-nitrophthalazin-5-yl]piperidin-4-ol |
| SMILES | COc1ccc(CNc2nncc3c(N4CCC(O)CC4)cc([N+](=O)[O-])cc23)cc1Cl |
| InChI | InChI=1S/C21H22ClN5O4/c1-31-20-3-2-13(8-18(20)22)11-23-21-16-9-14(27(29)30)10-19(17(16)12-24-25-21)26-6-4-15(28)5-7-26/h2-3,8-10,12,15,28H,4-7,11H2,1H3,(H,23,25) |
| InChIKey | AZSSSPCQFUMRHU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|