C22H23Cl2N5O5 — CID 22004377
1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 22004377) has the molecular formula C22H23Cl2N5O5 and a molecular weight of 508.36 g/mol. Its IUPAC name is 1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 22004377 |
| Molecular Formula | C22H23Cl2N5O5 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | COc1ccc(CNc2nnc(N3CCC(C(=O)O)CC3)c3ccc([N+](=O)[O-])cc23)cc1Cl.Cl |
| InChI | InChI=1S/C22H22ClN5O5.ClH/c1-33-19-5-2-13(10-18(19)23)12-24-20-17-11-15(28(31)32)3-4-16(17)21(26-25-20)27-8-6-14(7-9-27)22(29)30;/h2-5,10-11,14H,6-9,12H2,1H3,(H,24,25)(H,29,30);1H |
| InChIKey | RXUDFWAIDZTBKK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|