C23H27Cl2N5O4 — CID 22004382
2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidin-4-yl]ethanol;hydrochloride (PubChem CID 22004382) has the molecular formula C23H27Cl2N5O4 and a molecular weight of 508.41 g/mol. Its IUPAC name is 2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidin-4-yl]ethanol;hydrochloride.
| Compound Name | 2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidin-4-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 22004382 |
| Molecular Formula | C23H27Cl2N5O4 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 2-[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrophthalazin-1-yl]piperidin-4-yl]ethanol;hydrochloride |
| SMILES | COc1ccc(CNc2nnc(N3CCC(CCO)CC3)c3ccc([N+](=O)[O-])cc23)cc1Cl.Cl |
| InChI | InChI=1S/C23H26ClN5O4.ClH/c1-33-21-5-2-16(12-20(21)24)14-25-22-19-13-17(29(31)32)3-4-18(19)23(27-26-22)28-9-6-15(7-10-28)8-11-30;/h2-5,12-13,15,30H,6-11,14H2,1H3,(H,25,26);1H |
| InChIKey | JMZVNUCZMAENNI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|