C24H28ClN5O5 — CID 174373113
azane;ethyl 1-[4-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrophthalazin-1-yl]piperidine-4-carboxylate (PubChem CID 174373113) has the molecular formula C24H28ClN5O5 and a molecular weight of 501.97 g/mol. Its IUPAC name is azane;ethyl 1-[4-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrophthalazin-1-yl]piperidine-4-carboxylate.
| Compound Name | azane;ethyl 1-[4-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrophthalazin-1-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 174373113 |
| Molecular Formula | C24H28ClN5O5 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | azane;ethyl 1-[4-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrophthalazin-1-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nnc(Cc3ccc(OC)c(Cl)c3)c3cc([N+](=O)[O-])ccc23)CC1.N |
| InChI | InChI=1S/C24H25ClN4O5.H3N/c1-3-34-24(30)16-8-10-28(11-9-16)23-18-6-5-17(29(31)32)14-19(18)21(26-27-23)13-15-4-7-22(33-2)20(25)12-15;/h4-7,12,14,16H,3,8-11,13H2,1-2H3;1H3 |
| InChIKey | OWUKDMAKOPARQT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|