C22H21Cl2N5O — CID 10551169
(3-chloro-4-methoxyphenyl)methyl-[7-cyano-5-(3,6-dihydro-2H-pyridin-1-yl)phthalazin-1-yl]azanium chloride (PubChem CID 10551169) has the molecular formula C22H21Cl2N5O and a molecular weight of 442.35 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)methyl-[7-cyano-5-(3,6-dihydro-2H-pyridin-1-yl)phthalazin-1-yl]azanium chloride.
| Compound Name | (3-chloro-4-methoxyphenyl)methyl-[7-cyano-5-(3,6-dihydro-2H-pyridin-1-yl)phthalazin-1-yl]azanium chloride |
|---|---|
| PubChem CID | 10551169 |
| Molecular Formula | C22H21Cl2N5O |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)methyl-[7-cyano-5-(3,6-dihydro-2H-pyridin-1-yl)phthalazin-1-yl]azanium chloride |
| SMILES | COc1ccc(C[NH2+]c2nncc3c(N4CC=CCC4)cc(C#N)cc23)cc1Cl.[Cl-] |
| InChI | InChI=1S/C22H20ClN5O.ClH/c1-29-21-6-5-15(10-19(21)23)13-25-22-17-9-16(12-24)11-20(18(17)14-26-27-22)28-7-3-2-4-8-28;/h2-3,5-6,9-11,14H,4,7-8,13H2,1H3,(H,25,27);1H |
| InChIKey | AEZCAYPYOBSBPL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|