C20H22F4N2O — CID 90874062
4-(4-fluoro-N-methylanilino)-N-[[2-(trifluoromethyl)phenyl]methyl]pentanamide (PubChem CID 90874062) has the molecular formula C20H22F4N2O and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-(4-fluoro-N-methylanilino)-N-[[2-(trifluoromethyl)phenyl]methyl]pentanamide.
| Compound Name | 4-(4-fluoro-N-methylanilino)-N-[[2-(trifluoromethyl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 90874062 |
| Molecular Formula | C20H22F4N2O |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-(4-fluoro-N-methylanilino)-N-[[2-(trifluoromethyl)phenyl]methyl]pentanamide |
| SMILES | CC(CCC(=O)NCc1ccccc1C(F)(F)F)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22F4N2O/c1-14(26(2)17-10-8-16(21)9-11-17)7-12-19(27)25-13-15-5-3-4-6-18(15)20(22,23)24/h3-6,8-11,14H,7,12-13H2,1-2H3,(H,25,27) |
| InChIKey | VGHOWGHDCWGKOX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |