C37H32Br2N2O5 — CID 90874250
[[2,6-dibromo-4-[2-(4-phenoxyphenyl)ethylcarbamoyl]phenyl]methyl-[(3-phenoxyphenyl)methyl]amino] acetate (PubChem CID 90874250) has the molecular formula C37H32Br2N2O5 and a molecular weight of 744.48 g/mol. Its IUPAC name is [[2,6-dibromo-4-[2-(4-phenoxyphenyl)ethylcarbamoyl]phenyl]methyl-[(3-phenoxyphenyl)methyl]amino] acetate.
| Compound Name | [[2,6-dibromo-4-[2-(4-phenoxyphenyl)ethylcarbamoyl]phenyl]methyl-[(3-phenoxyphenyl)methyl]amino] acetate |
|---|---|
| PubChem CID | 90874250 |
| Molecular Formula | C37H32Br2N2O5 |
| Molecular Weight | 744.48 g/mol |
| Exact Mass | 742.07 |
| IUPAC Name | [[2,6-dibromo-4-[2-(4-phenoxyphenyl)ethylcarbamoyl]phenyl]methyl-[(3-phenoxyphenyl)methyl]amino] acetate |
| SMILES | CC(=O)ON(Cc1cccc(Oc2ccccc2)c1)Cc1c(Br)cc(C(=O)NCCc2ccc(Oc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C37H32Br2N2O5/c1-26(42)46-41(24-28-9-8-14-33(21-28)45-31-12-6-3-7-13-31)25-34-35(38)22-29(23-36(34)39)37(43)40-20-19-27-15-17-32(18-16-27)44-30-10-4-2-5-11-30/h2-18,21-23H,19-20,24-25H2,1H3,(H,40,43) |
| InChIKey | FXYSTIYMSYCGEI-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.48 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|