C10H21NO2 — CID 90875683
5-(aminomethyl)non-4-ene-1,9-diol (PubChem CID 90875683) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 5-(aminomethyl)non-4-ene-1,9-diol.
| Compound Name | 5-(aminomethyl)non-4-ene-1,9-diol |
|---|---|
| PubChem CID | 90875683 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 5-(aminomethyl)non-4-ene-1,9-diol |
| SMILES | NCC(=CCCCO)CCCCO |
| InChI | InChI=1S/C10H21NO2/c11-9-10(5-1-3-7-12)6-2-4-8-13/h5,12-13H,1-4,6-9,11H2 |
| InChIKey | NSQQYROHCYASJR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|