C8H17NO2 — CID 91186810
4-(aminomethyl)hept-3-ene-1,7-diol (PubChem CID 91186810) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 4-(aminomethyl)hept-3-ene-1,7-diol.
| Compound Name | 4-(aminomethyl)hept-3-ene-1,7-diol |
|---|---|
| PubChem CID | 91186810 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 4-(aminomethyl)hept-3-ene-1,7-diol |
| SMILES | NCC(=CCCO)CCCO |
| InChI | InChI=1S/C8H17NO2/c9-7-8(3-1-5-10)4-2-6-11/h3,10-11H,1-2,4-7,9H2 |
| InChIKey | AFEITJWBVKXICQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|