C24H24F2N4O5 — CID 90876283
3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4-dioxo-5,6,7,8-tetrahydroquinazoline-6-carboxamide (PubChem CID 90876283) has the molecular formula C24H24F2N4O5 and a molecular weight of 486.48 g/mol. Its IUPAC name is 3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4-dioxo-5,6,7,8-tetrahydroquinazoline-6-carboxamide.
| Compound Name | 3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4-dioxo-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 90876283 |
| Molecular Formula | C24H24F2N4O5 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4-dioxo-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
| SMILES | COc1cc(CNC(=O)C2CCc3c(c(=O)n(Cc4cc(F)c(O)c(F)c4)c(=O)n3C)C2)ccn1 |
| InChI | InChI=1S/C24H24F2N4O5/c1-29-19-4-3-15(22(32)28-11-13-5-6-27-20(9-13)35-2)10-16(19)23(33)30(24(29)34)12-14-7-17(25)21(31)18(26)8-14/h5-9,15,31H,3-4,10-12H2,1-2H3,(H,28,32) |
| InChIKey | JAYHZIGKCKADQW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |