C22H19F2N5O6S — CID 91204504
3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4,7-trioxo-8H-pyrimido[5,4-b][1,4]thiazine-6-carboxamide (PubChem CID 91204504) has the molecular formula C22H19F2N5O6S and a molecular weight of 519.49 g/mol. Its IUPAC name is 3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4,7-trioxo-8H-pyrimido[5,4-b][1,4]thiazine-6-carboxamide.
| Compound Name | 3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4,7-trioxo-8H-pyrimido[5,4-b][1,4]thiazine-6-carboxamide |
|---|---|
| PubChem CID | 91204504 |
| Molecular Formula | C22H19F2N5O6S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 3-[(3,5-difluoro-4-hydroxyphenyl)methyl]-N-[(2-methoxy-4-pyridinyl)methyl]-1-methyl-2,4,7-trioxo-8H-pyrimido[5,4-b][1,4]thiazine-6-carboxamide |
| SMILES | COc1cc(CNC(=O)C2Sc3c(n(C)c(=O)n(Cc4cc(F)c(O)c(F)c4)c3=O)NC2=O)ccn1 |
| InChI | InChI=1S/C22H19F2N5O6S/c1-28-18-16(21(33)29(22(28)34)9-11-5-12(23)15(30)13(24)6-11)36-17(20(32)27-18)19(31)26-8-10-3-4-25-14(7-10)35-2/h3-7,17,30H,8-9H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | FEPDEEFJIUHCLC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|