C20H20N2O2S — CID 90876330
[(2-methylphenyl)-phenylmethyl] 4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 90876330) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is [(2-methylphenyl)-phenylmethyl] 4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | [(2-methylphenyl)-phenylmethyl] 4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90876330 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(2-methylphenyl)-phenylmethyl] 4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC1=NC(=S)NCC1C(=O)OC(c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C20H20N2O2S/c1-13-8-6-7-11-16(13)18(15-9-4-3-5-10-15)24-19(23)17-12-21-20(25)22-14(17)2/h3-11,17-18H,12H2,1-2H3,(H,21,25) |
| InChIKey | QQPNXADOEOJDRI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|