methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate

C8H11NO4 — CID 90878039

IUPACmethyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate
SMILESCOC(=O)CCn1c(O)ccc1O
InChIInChI=1S/C8H11NO4/c1-13-8(12)4-5-9-6(10)2-3-7(9)11/h2-3,10-11H,4-5H2,1H3
InChIKeyWFMWFJGPMICTGU-UHFFFAOYSA-N
MW185.18 g/mol
LogP0.46
Rot. Bonds3

About methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate

methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate (PubChem CID 90878039) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate
PubChem CID90878039
Molecular FormulaC8H11NO4
Molecular Weight185.18 g/mol
Exact Mass185.07
IUPAC Namemethyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate
SMILESCOC(=O)CCn1c(O)ccc1O
InChIInChI=1S/C8H11NO4/c1-13-8(12)4-5-9-6(10)2-3-7(9)11/h2-3,10-11H,4-5H2,1H3
InChIKeyWFMWFJGPMICTGU-UHFFFAOYSA-N
XLogP0.46
TPSA71.69 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.18
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate?
The IUPAC name of methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate (CID 90878039) is methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate.
What is the SMILES notation for methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate?
The canonical SMILES for methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate is COC(=O)CCn1c(O)ccc1O.
What is the InChIKey of methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate?
The InChIKey is WFMWFJGPMICTGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-13-8(12)4-5-9-6(10)2-3-7(9)11/h2-3,10-11H,4-5H2,1H3.
What are the key properties of methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate?
methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate has a molecular weight of 185.18 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,5-dihydroxypyrrol-1-yl)propanoate is sourced from PubChem (CID 90878039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).