C10H24N2O4Si — CID 90878364
N-(6-aminohexyl)-1-trimethoxysilylformamide (PubChem CID 90878364) has the molecular formula C10H24N2O4Si and a molecular weight of 264.40 g/mol. Its IUPAC name is N-(6-aminohexyl)-1-trimethoxysilylformamide.
| Compound Name | N-(6-aminohexyl)-1-trimethoxysilylformamide |
|---|---|
| PubChem CID | 90878364 |
| Molecular Formula | C10H24N2O4Si |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(6-aminohexyl)-1-trimethoxysilylformamide |
| SMILES | CO[Si](OC)(OC)C(=O)NCCCCCCN |
| InChI | InChI=1S/C10H24N2O4Si/c1-14-17(15-2,16-3)10(13)12-9-7-5-4-6-8-11/h4-9,11H2,1-3H3,(H,12,13) |
| InChIKey | DRFDVMLBJWIQAP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|