C14H14N4O4S — CID 9087975
N'-[2-(2-cyanophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide (PubChem CID 9087975) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is N'-[2-(2-cyanophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide.
| Compound Name | N'-[2-(2-cyanophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 9087975 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N'-[2-(2-cyanophenoxy)acetyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetohydrazide |
| SMILES | N#Cc1ccccc1OCC(=O)NNC(=O)CN1CCSC1=O |
| InChI | InChI=1S/C14H14N4O4S/c15-7-10-3-1-2-4-11(10)22-9-13(20)17-16-12(19)8-18-5-6-23-14(18)21/h1-4H,5-6,8-9H2,(H,16,19)(H,17,20) |
| InChIKey | NRJKOCZCHKTHCP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|