C10H15NO — CID 90881942
4-hexa-1,3,5-trien-3-ylmorpholine (PubChem CID 90881942) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-hexa-1,3,5-trien-3-ylmorpholine.
| Compound Name | 4-hexa-1,3,5-trien-3-ylmorpholine |
|---|---|
| PubChem CID | 90881942 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-hexa-1,3,5-trien-3-ylmorpholine |
| SMILES | C=CC=C(C=C)N1CCOCC1 |
| InChI | InChI=1S/C10H15NO/c1-3-5-10(4-2)11-6-8-12-9-7-11/h3-5H,1-2,6-9H2 |
| InChIKey | ZDXAAEAZRHADFC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|