C18H28O3 — CID 90882214
2,3-dimethyl-4-[5-(2-methylpent-2-enoxy)cyclohexa-1,5-dien-1-yl]butanoic acid (PubChem CID 90882214) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2,3-dimethyl-4-[5-(2-methylpent-2-enoxy)cyclohexa-1,5-dien-1-yl]butanoic acid.
| Compound Name | 2,3-dimethyl-4-[5-(2-methylpent-2-enoxy)cyclohexa-1,5-dien-1-yl]butanoic acid |
|---|---|
| PubChem CID | 90882214 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2,3-dimethyl-4-[5-(2-methylpent-2-enoxy)cyclohexa-1,5-dien-1-yl]butanoic acid |
| SMILES | CCC=C(C)COC1=CC(CC(C)C(C)C(=O)O)=CCC1 |
| InChI | InChI=1S/C18H28O3/c1-5-7-13(2)12-21-17-9-6-8-16(11-17)10-14(3)15(4)18(19)20/h7-8,11,14-15H,5-6,9-10,12H2,1-4H3,(H,19,20) |
| InChIKey | DZCCZNWEHMIGNM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|