C22H26FN3O4 — CID 90882682
1-cyclopropyl-7-(4,5-dihydroxy-3,3a,4,5,6,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-yl)-6-fluoro-5,8-dimethylquinazoline-2,4-dione (PubChem CID 90882682) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-cyclopropyl-7-(4,5-dihydroxy-3,3a,4,5,6,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-yl)-6-fluoro-5,8-dimethylquinazoline-2,4-dione.
| Compound Name | 1-cyclopropyl-7-(4,5-dihydroxy-3,3a,4,5,6,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-yl)-6-fluoro-5,8-dimethylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 90882682 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-cyclopropyl-7-(4,5-dihydroxy-3,3a,4,5,6,8a-hexahydro-1H-cyclohepta[c]pyrrol-2-yl)-6-fluoro-5,8-dimethylquinazoline-2,4-dione |
| SMILES | Cc1c(F)c(N2CC3C=CCC(O)C(O)C3C2)c(C)c2c1c(=O)[nH]c(=O)n2C1CC1 |
| InChI | InChI=1S/C22H26FN3O4/c1-10-16-18(26(13-6-7-13)22(30)24-21(16)29)11(2)19(17(10)23)25-8-12-4-3-5-15(27)20(28)14(12)9-25/h3-4,12-15,20,27-28H,5-9H2,1-2H3,(H,24,29,30) |
| InChIKey | HBSHXLHNNBIKRC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|