C20H33NO2 — CID 90883368
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-ethyl-2-methyloct-6-ene-1,5-dione (PubChem CID 90883368) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-ethyl-2-methyloct-6-ene-1,5-dione.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-ethyl-2-methyloct-6-ene-1,5-dione |
|---|---|
| PubChem CID | 90883368 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-ethyl-2-methyloct-6-ene-1,5-dione |
| SMILES | CC=C(CC)C(=O)CCC(C)C(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C20H33NO2/c1-4-16(5-2)19(22)13-12-15(3)20(23)21-14-8-10-17-9-6-7-11-18(17)21/h4,15,17-18H,5-14H2,1-3H3 |
| InChIKey | ZZFPDWKJBDOLAZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|