C19H30N2O8 — CID 90883571
1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) 2-(3-propoxypropanoylamino)pentanedioate (PubChem CID 90883571) has the molecular formula C19H30N2O8 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) 2-(3-propoxypropanoylamino)pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) 2-(3-propoxypropanoylamino)pentanedioate |
|---|---|
| PubChem CID | 90883571 |
| Molecular Formula | C19H30N2O8 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) 2-(3-propoxypropanoylamino)pentanedioate |
| SMILES | CCCOCCC(=O)NC(CCC(=O)On1c(O)ccc1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O8/c1-5-11-27-12-10-14(22)20-13(18(26)28-19(2,3)4)6-9-17(25)29-21-15(23)7-8-16(21)24/h7-8,13,23-24H,5-6,9-12H2,1-4H3,(H,20,22) |
| InChIKey | UVSUFWYBQQUSPI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|